Type: Neutral
Formula: C20H32O
SMILES: |
OC1CCC2C3C(CCC12C)C1(C(CC(=CC1)C)CC3)C |
InChI: |
InChI=1/C20H32O/c1-13-8-10-19(2)14(12-13)4-5-15-16-6-7-18(21)20(16,3)11-9-17(15)19/h8,14-18,21H,4-7,9-12H2,1-3H3/t14-,15-,16+,17-,18-,19-,20+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 288.475 g/mol | logS: -5.79006 | SlogP: 4.9462 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.1243 | Sterimol/B1: 3.38825 | Sterimol/B2: 4.17394 | Sterimol/B3: 4.26949 |
Sterimol/B4: 4.56673 | Sterimol/L: 14.5723 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 502.98 | Positive charged surface: 385.075 | Negative charged surface: 117.905 | Volume: 313.125 |
Hydrophobic surface: 420.225 | Hydrophilic surface: 82.755 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 1 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 7 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |