Type: Neutral
Formula: C13H23N6O4P
SMILES: |
P(O)(O)(=O)COC(Cn1c2nc(nc(NCC)c2nc1)N(C)C)C |
InChI: |
InChI=1/C13H23N6O4P/c1-5-14-11-10-12(17-13(16-11)18(3)4)19(7-15-10)6-9(2)23-8-24(20,21)22/h7,9H,5-6,8H2,1-4H3,(H,14,16,17)(H2,20,21,22)/t9-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 358.339 g/mol | logS: -1.83586 | SlogP: 0.0606 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.185048 | Sterimol/B1: 2.48337 | Sterimol/B2: 3.88294 | Sterimol/B3: 5.47403 |
Sterimol/B4: 8.69846 | Sterimol/L: 14.5725 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 591.88 | Positive charged surface: 485.251 | Negative charged surface: 106.629 | Volume: 322.875 |
Hydrophobic surface: 388.339 | Hydrophilic surface: 203.541 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |