Type: Neutral
Formula: C13H24N6O4P+
SMILES: |
P(O)(O)(=O)COC(C[n+]1c2nc(nc(NCC)c2[nH]c1)N(C)C)C |
InChI: |
InChI=1/C13H23N6O4P/c1-5-14-11-10-12(17-13(16-11)18(3)4)19(7-15-10)6-9(2)23-8-24(20,21)22/h7,9H,5-6,8H2,1-4H3,(H3,14,16,17,20,21,22)/p+1/t9-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 359.347 g/mol | logS: -1.81147 | SlogP: -0.5203 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.196272 | Sterimol/B1: 2.27193 | Sterimol/B2: 4.11352 | Sterimol/B3: 5.3547 |
Sterimol/B4: 8.33724 | Sterimol/L: 14.6271 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 588.776 | Positive charged surface: 488.019 | Negative charged surface: 100.757 | Volume: 323 |
Hydrophobic surface: 358.11 | Hydrophilic surface: 230.666 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 4 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |