Type: Neutral
Formula: C14H14N6O3
SMILES: |
OCC(NC(=O)c1[nH]cnc1)C(=O)Nc1[nH]c2c(n1)cccc2 |
InChI: |
InChI=1/C14H14N6O3/c21-6-11(17-12(22)10-5-15-7-16-10)13(23)20-14-18-8-3-1-2-4-9(8)19-14/h1-5,7,11,21H,6H2,(H,15,16)(H,17,22)(H2,18,19,20,23)/t11-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 314.305 g/mol | logS: -3.10348 | SlogP: 0.0154 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0342674 | Sterimol/B1: 3.09331 | Sterimol/B2: 3.12355 | Sterimol/B3: 3.93127 |
Sterimol/B4: 6.35745 | Sterimol/L: 17.6521 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 558.473 | Positive charged surface: 370.655 | Negative charged surface: 187.817 | Volume: 276.375 |
Hydrophobic surface: 332.555 | Hydrophilic surface: 225.918 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 7 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |