Type: Neutral
Formula: C20H20N4O3
SMILES: |
OCC(NC(=O)Cc1ccccc1)C(=O)Nc1n[nH]c(c1)-c1ccccc1 |
InChI: |
InChI=1/C20H20N4O3/c25-13-17(21-19(26)11-14-7-3-1-4-8-14)20(27)22-18-12-16(23-24-18)15-9-5-2-6-10-15/h1-10,12,17,25H,11,13H2,(H,21,26)(H2,22,23,24,27)/t17-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 364.405 g/mol | logS: -4.52885 | SlogP: 1.73497 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.03795 | Sterimol/B1: 3.08077 | Sterimol/B2: 3.91073 | Sterimol/B3: 4.56749 |
Sterimol/B4: 6.06661 | Sterimol/L: 20.8032 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 654.863 | Positive charged surface: 386.78 | Negative charged surface: 268.083 | Volume: 346.125 |
Hydrophobic surface: 468.893 | Hydrophilic surface: 185.97 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |