Type: Neutral
Formula: C16H23N3O4S
SMILES: |
S(C(CCC)C(=O)NC(C)C)CC(=O)Nc1ccccc1[N+](=O)[O-] |
InChI: |
InChI=1/C16H23N3O4S/c1-4-7-14(16(21)17-11(2)3)24-10-15(20)18-12-8-5-6-9-13(12)19(22)23/h5-6,8-9,11,14H,4,7,10H2,1-3H3,(H,17,21)(H,18,20)/t14-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 353.443 g/mol | logS: -5.24027 | SlogP: 2.9598 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0869946 | Sterimol/B1: 2.41744 | Sterimol/B2: 4.52609 | Sterimol/B3: 4.5316 |
Sterimol/B4: 10.1805 | Sterimol/L: 16.6728 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 638.395 | Positive charged surface: 381.363 | Negative charged surface: 257.032 | Volume: 329.875 |
Hydrophobic surface: 420.588 | Hydrophilic surface: 217.807 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |