 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O1C(C)C(O)C(O)C(O)C1NC(=O)CCCCCN |
| InChI: | InChI=1/C12H24N2O5/c1-7-9(16)10(17)11(18)12(19-7)14-8(15)5-3-2-4-6-13/h7,9-12,16-18H,2-6,13H2,1H3,(H,14,15)/t7-,9-,10-,11-,12+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=47.9591 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 276.333 g/mol | logS: 0.1665 | SlogP: -1.5508 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0617564 | Sterimol/B1: 2.11925 | Sterimol/B2: 2.91964 | Sterimol/B3: 4.23245 | |||
| Sterimol/B4: 7.15991 | Sterimol/L: 16.361 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 535.47 | Positive charged surface: 412.193 | Negative charged surface: 123.278 | Volume: 265.125 | |||
| Hydrophobic surface: 291.283 | Hydrophilic surface: 244.187 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 5 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
