Type: Ionized
Formula: C9H20N5O3+
SMILES: |
O=C(NC(C(=O)[O-])C)C([NH3+])CCCNC(=[NH2+])N |
InChI: |
InChI=1/C9H19N5O3/c1-5(8(16)17)14-7(15)6(10)3-2-4-13-9(11)12/h5-6H,2-4,10H2,1H3,(H,14,15)(H,16,17)(H4,11,12,13)/p+1/t5-,6-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 246.291 g/mol | logS: -0.71327 | SlogP: -5.7049 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0562306 | Sterimol/B1: 2.5173 | Sterimol/B2: 4.03627 | Sterimol/B3: 4.46074 |
Sterimol/B4: 4.75815 | Sterimol/L: 15.6939 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 502.476 | Positive charged surface: 372.916 | Negative charged surface: 129.56 | Volume: 236.25 |
Hydrophobic surface: 163.96 | Hydrophilic surface: 338.516 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 1 | Acid groups: 2 | Basic groups: 4 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Parent related molecule:
|