Type: Neutral
Formula: C19H21N3O2
SMILES: |
OC(=O)Cc1cc2c([nH]c(-c3cccnc3)c2CCCCN)cc1 |
InChI: |
InChI=1/C19H21N3O2/c20-8-2-1-5-15-16-10-13(11-18(23)24)6-7-17(16)22-19(15)14-4-3-9-21-12-14/h3-4,6-7,9-10,12,22H,1-2,5,8,11,20H2,(H,23,24) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 323.396 g/mol | logS: -2.97262 | SlogP: 3.13834 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0851211 | Sterimol/B1: 2.53125 | Sterimol/B2: 2.97153 | Sterimol/B3: 4.4981 |
Sterimol/B4: 8.93103 | Sterimol/L: 15.4107 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 599.134 | Positive charged surface: 426.577 | Negative charged surface: 167.887 | Volume: 321.875 |
Hydrophobic surface: 397.345 | Hydrophilic surface: 201.789 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |