 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | o1c(ccc1C[NH+]1CCOCC1)C(=O)N(C(C(=O)NC1CCCC1)c1ccc(cc1)C)c1c c2c(nc1)cccc2 |
| InChI: | InChI=1/C33H36N4O4/c1-23-10-12-24(13-11-23)31(32(38)35-26-7-3-4-8-26)37(27-20-25-6-2-5-9-29(25)34-21-27)33(39)30-15-14-28(41-30)22-36-16-18-40-19-17-36/h2,5-6,9-15,20-21,26,31H,3-4,7-8,16-19,22H2,1H3,(H,35,38)/p+1/t31-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=144.233 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 553.683 g/mol | logS: -7.25076 | SlogP: 4.36012 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.112713 | Sterimol/B1: 2.14497 | Sterimol/B2: 4.84454 | Sterimol/B3: 4.93215 | |||
| Sterimol/B4: 10.4236 | Sterimol/L: 19.3212 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 829.875 | Positive charged surface: 582.322 | Negative charged surface: 246.421 | Volume: 549.625 | |||
| Hydrophobic surface: 728.039 | Hydrophilic surface: 101.836 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 1 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
