Type: Neutral
Formula: C18H22N4O3
SMILES: |
OCC(NC(=O)c1nc2c(nc1)cccc2)C(=O)NC1CCCCC1 |
InChI: |
InChI=1/C18H22N4O3/c23-11-16(18(25)20-12-6-2-1-3-7-12)22-17(24)15-10-19-13-8-4-5-9-14(13)21-15/h4-5,8-10,12,16,23H,1-3,6-7,11H2,(H,20,25)(H,22,24)/t16-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 342.399 g/mol | logS: -2.4243 | SlogP: 1.1694 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0548206 | Sterimol/B1: 2.9997 | Sterimol/B2: 3.71054 | Sterimol/B3: 3.86406 |
Sterimol/B4: 6.64265 | Sterimol/L: 18.3704 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 614.698 | Positive charged surface: 430.814 | Negative charged surface: 183.884 | Volume: 325.25 |
Hydrophobic surface: 460.54 | Hydrophilic surface: 154.158 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |