Type: Neutral
Formula: C18H28N2O3
SMILES: |
O(Cc1ccccc1)C(=O)NC(C(CC)C)C(=O)NC(CC)C |
InChI: |
InChI=1/C18H28N2O3/c1-5-13(3)16(17(21)19-14(4)6-2)20-18(22)23-12-15-10-8-7-9-11-15/h7-11,13-14,16H,5-6,12H2,1-4H3,(H,19,21)(H,20,22)/t13-,14-,16-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 320.433 g/mol | logS: -3.88256 | SlogP: 3.5086 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0637442 | Sterimol/B1: 2.10832 | Sterimol/B2: 2.58491 | Sterimol/B3: 4.76929 |
Sterimol/B4: 8.44464 | Sterimol/L: 17.9173 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 620.167 | Positive charged surface: 404.283 | Negative charged surface: 215.884 | Volume: 335.875 |
Hydrophobic surface: 472.837 | Hydrophilic surface: 147.33 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |