Type: Neutral
Formula: C11H18N2O4
SMILES: |
O1C(C)C(O)C(O)C1N1CC(=CCC1)C(=O)N |
InChI: |
InChI=1/C11H18N2O4/c1-6-8(14)9(15)11(17-6)13-4-2-3-7(5-13)10(12)16/h3,6,8-9,11,14-15H,2,4-5H2,1H3,(H2,12,16)/t6-,8-,9+,11-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 242.275 g/mol | logS: -0.4075 | SlogP: -1.4296 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0796737 | Sterimol/B1: 2.59527 | Sterimol/B2: 3.63986 | Sterimol/B3: 3.76432 |
Sterimol/B4: 5.14533 | Sterimol/L: 13.4078 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 454.459 | Positive charged surface: 329.427 | Negative charged surface: 125.032 | Volume: 225.5 |
Hydrophobic surface: 223.706 | Hydrophilic surface: 230.753 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |