 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(Nc1nnn[n-]1)C([NH3+])CCCCNC([NH3+])C |
| InChI: | InChI=1/C9H20N8O/c1-6(10)12-5-3-2-4-7(11)8(18)13-9-14-16-17-15-9/h6-7,12H,2-5,10-11H2,1H3,(H2,13,14,15,16,17,18)/p+1/t6-,7-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=-28.9817 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 257.322 g/mol | logS: -0.07781 | SlogP: -3.2744 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0496375 | Sterimol/B1: 2.43032 | Sterimol/B2: 4.41901 | Sterimol/B3: 4.90141 | |||
| Sterimol/B4: 5.1635 | Sterimol/L: 17.1765 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 529.59 | Positive charged surface: 358.526 | Negative charged surface: 171.064 | Volume: 250.625 | |||
| Hydrophobic surface: 196.701 | Hydrophilic surface: 332.889 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 4 | Basic groups: 2 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
