Type: Neutral
Formula: C10H19NO8
SMILES: |
O1C(C(O)C(O)CO)C(N)C(O)CC1(OC)C(O)=O |
InChI: |
InChI=1/C10H19NO8/c1-18-10(9(16)17)2-4(13)6(11)8(19-10)7(15)5(14)3-12/h4-8,12-15H,2-3,11H2,1H3,(H,16,17)/t4-,5+,6-,7+,8+,10+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 281.261 g/mol | logS: 0.84057 | SlogP: -3.3951 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.308229 | Sterimol/B1: 2.55509 | Sterimol/B2: 3.30305 | Sterimol/B3: 5.47825 |
Sterimol/B4: 6.87396 | Sterimol/L: 12.3352 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 456.31 | Positive charged surface: 349.362 | Negative charged surface: 106.949 | Volume: 235.25 |
Hydrophobic surface: 181.643 | Hydrophilic surface: 274.667 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 7 | Hydrogen bond acceptors: 9 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 6 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |