Type: Neutral
Formula: C15H22FN3O2
SMILES: |
Fc1ccc(cc1)CCNC(=O)C(NC(=O)N)C(CC)C |
InChI: |
InChI=1/C15H22FN3O2/c1-3-10(2)13(19-15(17)21)14(20)18-9-8-11-4-6-12(16)7-5-11/h4-7,10,13H,3,8-9H2,1-2H3,(H,18,20)(H3,17,19,21)/t10-,13+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 295.358 g/mol | logS: -3.25321 | SlogP: 1.56737 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0613576 | Sterimol/B1: 2.18856 | Sterimol/B2: 2.83631 | Sterimol/B3: 4.02655 |
Sterimol/B4: 7.29177 | Sterimol/L: 16.5301 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 558.034 | Positive charged surface: 356.45 | Negative charged surface: 201.585 | Volume: 289.25 |
Hydrophobic surface: 376.322 | Hydrophilic surface: 181.712 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |