Type: Neutral
Formula: C17H28N2O3S
SMILES: |
S(=O)(=O)(NC(CC(C)C)C(=O)NC(CC)C)c1ccc(cc1)C |
InChI: |
InChI=1/C17H28N2O3S/c1-6-14(5)18-17(20)16(11-12(2)3)19-23(21,22)15-9-7-13(4)8-10-15/h7-10,12,14,16,19H,6,11H2,1-5H3,(H,18,20)/t14-,16-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 340.488 g/mol | logS: -4.28496 | SlogP: 2.60272 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.151439 | Sterimol/B1: 3.59782 | Sterimol/B2: 4.62166 | Sterimol/B3: 5.56794 |
Sterimol/B4: 6.0318 | Sterimol/L: 15.3412 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 594.82 | Positive charged surface: 375.777 | Negative charged surface: 219.043 | Volume: 338.125 |
Hydrophobic surface: 427.816 | Hydrophilic surface: 167.004 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |