Type: Neutral
Formula: C16H24N2O3
SMILES: |
O(CC)C(=O)NC(CC(=O)NC(CC)C)c1ccccc1 |
InChI: |
InChI=1/C16H24N2O3/c1-4-12(3)17-15(19)11-14(18-16(20)21-5-2)13-9-7-6-8-10-13/h6-10,12,14H,4-5,11H2,1-3H3,(H,17,19)(H,18,20)/t12-,14+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 292.379 g/mol | logS: -2.84572 | SlogP: 2.8741 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.141991 | Sterimol/B1: 2.16754 | Sterimol/B2: 5.92875 | Sterimol/B3: 6.30704 |
Sterimol/B4: 6.38462 | Sterimol/L: 13.6505 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 597.155 | Positive charged surface: 406.346 | Negative charged surface: 190.809 | Volume: 302.875 |
Hydrophobic surface: 458 | Hydrophilic surface: 139.155 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |