Type: Neutral
Formula: C14H16N4O3
SMILES: |
OCC(NC(=O)c1[nH]cnc1)C(=O)NCc1ccccc1 |
InChI: |
InChI=1/C14H16N4O3/c19-8-12(18-14(21)11-7-15-9-17-11)13(20)16-6-10-4-2-1-3-5-10/h1-5,7,9,12,19H,6,8H2,(H,15,17)(H,16,20)(H,18,21)/t12-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 288.307 g/mol | logS: -2.02608 | SlogP: 0.0832 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0683469 | Sterimol/B1: 3.31758 | Sterimol/B2: 3.75697 | Sterimol/B3: 3.93902 |
Sterimol/B4: 4.54186 | Sterimol/L: 17.4379 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 546.603 | Positive charged surface: 368.293 | Negative charged surface: 178.31 | Volume: 268.125 |
Hydrophobic surface: 373.617 | Hydrophilic surface: 172.986 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |