Type: Neutral
Formula: C9H14N4O5
SMILES: |
O1C(CO)C(O)C(O)C1N1C=CC(=NC1=O)NN |
InChI: |
InChI=1/C9H14N4O5/c10-12-5-1-2-13(9(17)11-5)8-7(16)6(15)4(3-14)18-8/h1-2,4,6-8,14-16H,3,10H2,(H,11,12,17)/t4-,6-,7-,8-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 258.234 g/mol | logS: -0.05234 | SlogP: -2.7635 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0891199 | Sterimol/B1: 2.25799 | Sterimol/B2: 3.23072 | Sterimol/B3: 4.10914 |
Sterimol/B4: 5.8032 | Sterimol/L: 13.2882 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 450.074 | Positive charged surface: 316.844 | Negative charged surface: 133.23 | Volume: 215.875 |
Hydrophobic surface: 154.815 | Hydrophilic surface: 295.259 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |