 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | OC(CNC(=O)C(NC(CCc1ccccc1)C(=O)[O-])Cc1ccccc1)C(=O)[O-] |
| InChI: | InChI=1/C22H26N2O6/c25-19(22(29)30)14-23-20(26)18(13-16-9-5-2-6-10-16)24-17(21(27)28)12-11-15-7-3-1-4-8-15/h1-10,17-19,24-25H,11-14H2,(H,23,26)(H,27,28)(H,29,30)/p-2/t17-,18-,19-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=103.401 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 412.442 g/mol | logS: -3.7006 | SlogP: -1.83446 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0816976 | Sterimol/B1: 3.28775 | Sterimol/B2: 5.05831 | Sterimol/B3: 6.82109 | |||
| Sterimol/B4: 8.24179 | Sterimol/L: 17.4244 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 703.851 | Positive charged surface: 368.66 | Negative charged surface: 335.191 | Volume: 388.75 | |||
| Hydrophobic surface: 492.222 | Hydrophilic surface: 211.629 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 4 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
