Type: Neutral
Formula: C15H21N3O5
SMILES: |
Oc1ccc(cc1)C(=O)NCC(=O)NC(CCCCN)C(O)=O |
InChI: |
InChI=1/C15H21N3O5/c16-8-2-1-3-12(15(22)23)18-13(20)9-17-14(21)10-4-6-11(19)7-5-10/h4-7,12,19H,1-3,8-9,16H2,(H,17,21)(H,18,20)(H,22,23)/t12-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 323.349 g/mol | logS: -1.63414 | SlogP: -0.1796 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0516189 | Sterimol/B1: 2.84051 | Sterimol/B2: 3.91809 | Sterimol/B3: 4.84282 |
Sterimol/B4: 7.37325 | Sterimol/L: 18.8314 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 607.38 | Positive charged surface: 406.671 | Negative charged surface: 200.709 | Volume: 301.125 |
Hydrophobic surface: 321.461 | Hydrophilic surface: 285.919 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 6 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |