Type: Neutral
Formula: C10H15N3O5
SMILES: |
O1C(CCO)C(O)C(O)C1N1C=CC(=NC1=O)N |
InChI: |
InChI=1/C10H15N3O5/c11-6-1-3-13(10(17)12-6)9-8(16)7(15)5(18-9)2-4-14/h1,3,5,7-9,14-16H,2,4H2,(H2,11,12,17)/t5-,7-,8+,9-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 257.246 g/mol | logS: -0.27418 | SlogP: -1.878 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.124034 | Sterimol/B1: 2.63329 | Sterimol/B2: 4.70565 | Sterimol/B3: 4.81654 |
Sterimol/B4: 4.91531 | Sterimol/L: 13.1997 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 451.05 | Positive charged surface: 326.966 | Negative charged surface: 124.084 | Volume: 221.875 |
Hydrophobic surface: 195.005 | Hydrophilic surface: 256.045 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |