Type: Neutral
Formula: C11H12F2N2O5
SMILES: |
FC(F)=CC1=CN(C2OC(CO)C(O)C2)C(=O)NC1=O |
InChI: |
InChI=1/C11H12F2N2O5/c12-8(13)1-5-3-15(11(19)14-10(5)18)9-2-6(17)7(4-16)20-9/h1,3,6-7,9,16-17H,2,4H2,(H,14,18,19)/t6-,7+,9+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 290.222 g/mol | logS: -1.56026 | SlogP: -0.2204 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.162021 | Sterimol/B1: 3.03823 | Sterimol/B2: 3.99591 | Sterimol/B3: 4.53953 |
Sterimol/B4: 4.98272 | Sterimol/L: 13.5397 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 466.428 | Positive charged surface: 281.856 | Negative charged surface: 184.572 | Volume: 227.875 |
Hydrophobic surface: 234.376 | Hydrophilic surface: 232.052 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |