Type: Neutral
Formula: C16H18N2O3
SMILES: |
o1cccc1C(N1CCCC1C(O)=O)c1ccncc1C |
InChI: |
InChI=1/C16H18N2O3/c1-11-10-17-7-6-12(11)15(14-5-3-9-21-14)18-8-2-4-13(18)16(19)20/h3,5-7,9-10,13,15H,2,4,8H2,1H3,(H,19,20)/t13-,15-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 286.331 g/mol | logS: -2.22635 | SlogP: 2.71692 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.3118 | Sterimol/B1: 2.41041 | Sterimol/B2: 5.15996 | Sterimol/B3: 5.60741 |
Sterimol/B4: 6.1897 | Sterimol/L: 11.7606 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 474.343 | Positive charged surface: 330.341 | Negative charged surface: 144.002 | Volume: 270 |
Hydrophobic surface: 395.786 | Hydrophilic surface: 78.557 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |