 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | ClCCN(CCCl)c1ccc(cc1)CC(NC(=O)C)C(=O)NCC(=O)NCC(O)=O |
| InChI: | InChI=1/C19H26Cl2N4O5/c1-13(26)24-16(19(30)23-11-17(27)22-12-18(28)29)10-14-2-4-15(5-3-14)25(8-6-20)9-7-21/h2-5,16H,6-12H2,1H3,(H,22,27)(H,23,30)(H,24,26)(H,28,29)/t16-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=118.136 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 461.346 g/mol | logS: -3.39879 | SlogP: 0.33477 | Reactive groups: 1 | |||
| Topological Properties | ||||||
| Globularity: 0.024991 | Sterimol/B1: 2.17152 | Sterimol/B2: 3.24142 | Sterimol/B3: 3.30713 | |||
| Sterimol/B4: 11.6877 | Sterimol/L: 22.022 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 752.471 | Positive charged surface: 431.023 | Negative charged surface: 321.448 | Volume: 409.125 | |||
| Hydrophobic surface: 369.037 | Hydrophilic surface: 383.434 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 1 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
Ions/Tautomers related molecules
