Type: Neutral
Formula: C10H12N2O5
SMILES: |
O1C(C2OC2C1N1C=C(C)C(=O)NC1=O)CO |
InChI: |
InChI=1/C10H12N2O5/c1-4-2-12(10(15)11-8(4)14)9-7-6(17-7)5(3-13)16-9/h2,5-7,9,13H,3H2,1H3,(H,11,14,15)/t5-,6-,7-,9+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 240.215 g/mol | logS: -0.58516 | SlogP: -1.0734 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.0920653 | Sterimol/B1: 2.04248 | Sterimol/B2: 3.19032 | Sterimol/B3: 3.46455 |
Sterimol/B4: 7.03924 | Sterimol/L: 11.4764 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 414.312 | Positive charged surface: 256.323 | Negative charged surface: 157.989 | Volume: 203 |
Hydrophobic surface: 221.08 | Hydrophilic surface: 193.232 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |