Type: Neutral
Formula: C12H17N3O5
SMILES: |
O1C(CO)C(NC(=O)C)CC1N1C=C(C)C(=O)NC1=O |
InChI: |
InChI=1/C12H17N3O5/c1-6-4-15(12(19)14-11(6)18)10-3-8(13-7(2)17)9(5-16)20-10/h4,8-10,16H,3,5H2,1-2H3,(H,13,17)(H,14,18,19)/t8-,9+,10+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 283.284 g/mol | logS: -0.67538 | SlogP: -0.946 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0593985 | Sterimol/B1: 3.03932 | Sterimol/B2: 3.91979 | Sterimol/B3: 4.9464 |
Sterimol/B4: 5.5764 | Sterimol/L: 14.5428 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 506.534 | Positive charged surface: 331.738 | Negative charged surface: 174.796 | Volume: 249.375 |
Hydrophobic surface: 290.556 | Hydrophilic surface: 215.978 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |