Type: Neutral
Formula: C19H30N2O3
SMILES: |
O(C(=O)C(NC(=O)NCC(CCCC)CC)Cc1ccccc1)C |
InChI: |
InChI=1/C19H30N2O3/c1-4-6-10-15(5-2)14-20-19(23)21-17(18(22)24-3)13-16-11-8-7-9-12-16/h7-9,11-12,15,17H,4-6,10,13-14H2,1-3H3,(H2,20,21,23)/t15-,17+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 334.46 g/mol | logS: -4.6335 | SlogP: 3.28627 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.151212 | Sterimol/B1: 2.27668 | Sterimol/B2: 4.69614 | Sterimol/B3: 7.02837 |
Sterimol/B4: 7.72071 | Sterimol/L: 15.7508 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 673.498 | Positive charged surface: 480.626 | Negative charged surface: 192.872 | Volume: 353.625 |
Hydrophobic surface: 557.56 | Hydrophilic surface: 115.938 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |