Type: Neutral
Formula: C16H18N2O3
SMILES: |
o1cccc1C(N1CC(CCC1)C(O)=O)c1ccncc1 |
InChI: |
InChI=1/C16H18N2O3/c19-16(20)13-3-1-9-18(11-13)15(14-4-2-10-21-14)12-5-7-17-8-6-12/h2,4-8,10,13,15H,1,3,9,11H2,(H,19,20)/t13-,15-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 286.331 g/mol | logS: -1.82236 | SlogP: 2.6561 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.180212 | Sterimol/B1: 2.52354 | Sterimol/B2: 3.43605 | Sterimol/B3: 4.23898 |
Sterimol/B4: 8.15859 | Sterimol/L: 13.2056 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 508.279 | Positive charged surface: 347.648 | Negative charged surface: 160.631 | Volume: 276.375 |
Hydrophobic surface: 398.485 | Hydrophilic surface: 109.794 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |