Type: Neutral
Formula: C11H19N5O4
SMILES: |
O=C1N=C(N)N(C=2NCC(N(C1=2)C(O)C(O)CO)C)C |
InChI: |
InChI=1/C11H19N5O4/c1-5-3-13-8-7(9(19)14-11(12)15(8)2)16(5)10(20)6(18)4-17/h5-6,10,13,17-18,20H,3-4H2,1-2H3,(H2,12,14,19)/t5-,6+,10+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 285.304 g/mol | logS: -0.34212 | SlogP: -3.0925 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0994164 | Sterimol/B1: 1.969 | Sterimol/B2: 2.94993 | Sterimol/B3: 5.1265 |
Sterimol/B4: 6.82112 | Sterimol/L: 13.6391 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 465.321 | Positive charged surface: 358.234 | Negative charged surface: 107.087 | Volume: 250.125 |
Hydrophobic surface: 197.104 | Hydrophilic surface: 268.217 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |