Type: Ionized
Formula: C6H12O7P-
SMILES: |
P(O)(O)(=O)C(C(O)(CCO)C)C(=O)[O-] |
InChI: |
InChI=1/C6H13O7P/c1-6(10,2-3-7)4(5(8)9)14(11,12)13/h4,7,10H,2-3H2,1H3,(H,8,9)(H2,11,12,13)/p-1/t4-,6-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 227.129 g/mol | logS: 0.69879 | SlogP: -3.6542 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.252098 | Sterimol/B1: 2.26716 | Sterimol/B2: 2.41883 | Sterimol/B3: 4.52059 |
Sterimol/B4: 5.91385 | Sterimol/L: 11.1451 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 365.465 | Positive charged surface: 191.424 | Negative charged surface: 174.042 | Volume: 176.125 |
Hydrophobic surface: 101.172 | Hydrophilic surface: 264.293 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 5 | Acid groups: 2 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Parent related molecule:
|