Type: Neutral
Formula: C17H22N4O3
SMILES: |
O(C(=O)C(NC(=O)NCCCn1ccnc1)Cc1ccccc1)C |
InChI: |
InChI=1/C17H22N4O3/c1-24-16(22)15(12-14-6-3-2-4-7-14)20-17(23)19-8-5-10-21-11-9-18-13-21/h2-4,6-7,9,11,13,15H,5,8,10,12H2,1H3,(H2,19,20,23)/t15-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 330.388 g/mol | logS: -2.33621 | SlogP: 1.62307 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.0551646 | Sterimol/B1: 2.04699 | Sterimol/B2: 3.36329 | Sterimol/B3: 3.5003 |
Sterimol/B4: 10.9168 | Sterimol/L: 16.7142 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 634.17 | Positive charged surface: 462.448 | Negative charged surface: 171.721 | Volume: 326.25 |
Hydrophobic surface: 517.066 | Hydrophilic surface: 117.104 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |