Type: Neutral
Formula: C9H15N5O4
SMILES: |
OC12NC(CN=C1NC(=NC2=O)N)C(O)C(O)C |
InChI: |
InChI=1/C9H15N5O4/c1-3(15)5(16)4-2-11-6-9(18,14-4)7(17)13-8(10)12-6/h3-5,14-16,18H,2H2,1H3,(H3,10,11,12,13,17)/t3-,4-,5-,9-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 257.25 g/mol | logS: -0.51465 | SlogP: -3.7685 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.099805 | Sterimol/B1: 3.24332 | Sterimol/B2: 3.7184 | Sterimol/B3: 3.75998 |
Sterimol/B4: 4.88796 | Sterimol/L: 13.6932 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 437.988 | Positive charged surface: 298.775 | Negative charged surface: 139.213 | Volume: 216.75 |
Hydrophobic surface: 123.141 | Hydrophilic surface: 314.847 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 6 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |