Type: Neutral
Formula: C16H27N3O3
SMILES: |
OC(=O)CCCC(=O)C(NC)(N)C(CC1C=CC(N)C=C1)C |
InChI: |
InChI=1/C16H27N3O3/c1-11(10-12-6-8-13(17)9-7-12)16(18,19-2)14(20)4-3-5-15(21)22/h6-9,11-13,19H,3-5,10,17-18H2,1-2H3,(H,21,22)/t11-,12-,13-,16-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 309.41 g/mol | logS: -0.92468 | SlogP: 0.7805 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.0663677 | Sterimol/B1: 3.50938 | Sterimol/B2: 3.55742 | Sterimol/B3: 4.13711 |
Sterimol/B4: 6.79053 | Sterimol/L: 17.2922 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 559.105 | Positive charged surface: 395.693 | Negative charged surface: 163.412 | Volume: 306.875 |
Hydrophobic surface: 266.294 | Hydrophilic surface: 292.811 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |