Type: Ionized
Formula: C10H18NO5-
| SMILES: |
OC(C(C(O)C)(C)C)C(=O)NCCC(=O)[O-] |
| InChI: |
InChI=1/C10H19NO5/c1-6(12)10(2,3)8(15)9(16)11-5-4-7(13)14/h6,8,12,15H,4-5H2,1-3H3,(H,11,16)(H,13,14)/p-1/t6-,8+/m0/s1 |
MOE's Descriptors
| Physical Properties | | | |
| Molecular Weight: 232.256 g/mol | logS: -0.42876 | SlogP: -1.9895 | Reactive groups: 0 |
| | | | |
| Topological Properties | | | |
| Globularity: 0.139255 | Sterimol/B1: 2.35079 | Sterimol/B2: 3.08229 | Sterimol/B3: 3.73676 |
| Sterimol/B4: 6.83591 | Sterimol/L: 12.6125 | | | |
| | | | |
| Surface and Volume Properties | | | |
| Accessible surface: 433.766 | Positive charged surface: 269.559 | Negative charged surface: 164.207 | Volume: 217.875 |
| Hydrophobic surface: 202.905 | Hydrophilic surface: 230.861 | | |
| | | | |
| Pharmacophoric Properties | | | |
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 2 | Basic groups: 0 |
| Chiral centers: 2 | | | |
| | | | |
| Drug- and Lead-like Properties | | | |
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
| |
search links for this molecule: |
|
 |
|
|
Parent related molecule:
|