Type: Neutral
Formula: C10H12O7S
SMILES: |
S(Oc1ccc(cc1OC)CCC(O)=O)(O)(=O)=O |
InChI: |
InChI=1/C10H12O7S/c1-16-9-6-7(3-5-10(11)12)2-4-8(9)17-18(13,14)15/h2,4,6H,3,5H2,1H3,(H,11,12)(H,13,14,15) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 276.265 g/mol | logS: -1.5309 | SlogP: 0.32827 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0573999 | Sterimol/B1: 2.34279 | Sterimol/B2: 2.87335 | Sterimol/B3: 3.02034 |
Sterimol/B4: 7.16747 | Sterimol/L: 15.0275 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 460.195 | Positive charged surface: 267.23 | Negative charged surface: 192.965 | Volume: 219.5 |
Hydrophobic surface: 227.816 | Hydrophilic surface: 232.379 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules
|