Type: Ionized
Formula: C5H10NO9P-2
| SMILES: |
P(OCC(O)C(O)C(O)C(=O)NO)(=O)([O-])[O-] |
| InChI: |
InChI=1/C5H12NO9P/c7-2(1-15-16(12,13)14)3(8)4(9)5(10)6-11/h2-4,7-9,11H,1H2,(H,6,10)(H2,12,13,14)/p-2/t2-,3+,4-/m0/s1 |
MOE's Descriptors
| Physical Properties | | | |
| Molecular Weight: 259.107 g/mol | logS: 1.20705 | SlogP: -5.6504 | Reactive groups: 0 |
| | | | |
| Topological Properties | | | |
| Globularity: 0.112437 | Sterimol/B1: 2.57011 | Sterimol/B2: 3.71679 | Sterimol/B3: 3.80489 |
| Sterimol/B4: 4.14463 | Sterimol/L: 13.1499 | | | |
| | | | |
| Surface and Volume Properties | | | |
| Accessible surface: 403.423 | Positive charged surface: 174.346 | Negative charged surface: 229.077 | Volume: 180.75 |
| Hydrophobic surface: 65.9897 | Hydrophilic surface: 337.4333 | | |
| | | | |
| Pharmacophoric Properties | | | |
| Hydrogen bond donors: 5 | Hydrogen bond acceptors: 6 | Acid groups: 3 | Basic groups: 0 |
| Chiral centers: 3 | | | |
| | | | |
| Drug- and Lead-like Properties | | | |
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | |
| |
search links for this molecule: |
|
 |
|
|
Parent related molecule:
|