Type: Neutral
Formula: C6H17NO7P2
SMILES: |
P(O)(O)(=O)C(P(O)(O)=O)(O)CCCN(C)C |
InChI: |
InChI=1/C6H17NO7P2/c1-7(2)5-3-4-6(8,15(9,10)11)16(12,13)14/h8H,3-5H2,1-2H3,(H2,9,10,11)(H2,12,13,14) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 277.15 g/mol | logS: 1.53769 | SlogP: -2.8107 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.1978 | Sterimol/B1: 3.32899 | Sterimol/B2: 3.50806 | Sterimol/B3: 3.78389 |
Sterimol/B4: 5.29396 | Sterimol/L: 11.9699 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 438.109 | Positive charged surface: 301.206 | Negative charged surface: 136.903 | Volume: 218.75 |
Hydrophobic surface: 186.463 | Hydrophilic surface: 251.646 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 7 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules
|