 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | OCC(NC(=O)c1ccc(cc1)C(=O)NC(C(=O)[O-])CO)C(=O)[O-] |
| InChI: | InChI=1/C14H16N2O8/c17-5-9(13(21)22)15-11(19)7-1-2-8(4-3-7)12(20)16-10(6-18)14(23)24/h1-4,9-10,17-18H,5-6H2,(H,15,19)(H,16,20)(H,21,22)(H,23,24)/p-2/t9-,10-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=69.2943 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 338.272 g/mol | logS: -1.78464 | SlogP: -4.6322 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0480787 | Sterimol/B1: 2.43837 | Sterimol/B2: 3.56377 | Sterimol/B3: 3.56851 | |||
| Sterimol/B4: 6.17589 | Sterimol/L: 17.3015 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 545.005 | Positive charged surface: 269.063 | Negative charged surface: 275.942 | Volume: 282.75 | |||
| Hydrophobic surface: 241.177 | Hydrophilic surface: 303.828 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 4 | Acid groups: 4 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
