Type: Neutral
Formula: C21H23N3O
SMILES: |
O=C(NCCCn1ccnc1)CC(c1ccccc1)c1ccccc1 |
InChI: |
InChI=1/C21H23N3O/c25-21(23-12-7-14-24-15-13-22-17-24)16-20(18-8-3-1-4-9-18)19-10-5-2-6-11-19/h1-6,8-11,13,15,17,20H,7,12,14,16H2,(H,23,25) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 333.435 g/mol | logS: -3.6112 | SlogP: 3.878 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0824198 | Sterimol/B1: 2.097 | Sterimol/B2: 3.46663 | Sterimol/B3: 4.33188 |
Sterimol/B4: 8.82906 | Sterimol/L: 18.2138 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 641.737 | Positive charged surface: 439.327 | Negative charged surface: 202.411 | Volume: 344.5 |
Hydrophobic surface: 571.005 | Hydrophilic surface: 70.732 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |