 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | OC(C(NC(=O)c1ccc(cc1)C(=O)NC(C(O)C)C(=O)[O-])C(=O)[O-])C |
| InChI: | InChI=1/C16H20N2O8/c1-7(19)11(15(23)24)17-13(21)9-3-5-10(6-4-9)14(22)18-12(8(2)20)16(25)26/h3-8,11-12,19-20H,1-2H3,(H,17,21)(H,18,22)(H,23,24)(H,25,26)/p-2/t7-,8-,11-,12+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=81.9942 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 366.326 g/mol | logS: -2.43906 | SlogP: -3.8552 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0525913 | Sterimol/B1: 3.43308 | Sterimol/B2: 3.49524 | Sterimol/B3: 3.86212 | |||
| Sterimol/B4: 5.11076 | Sterimol/L: 18.063 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 600.633 | Positive charged surface: 308.071 | Negative charged surface: 292.562 | Volume: 319.75 | |||
| Hydrophobic surface: 274.905 | Hydrophilic surface: 325.728 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 4 | Acid groups: 4 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
