Type: Neutral
Formula: C18H20N2O2S2
SMILES: |
s1c2CC(CCc2c(C(=O)N)c1NC(=O)\C=C/c1sccc1)CC |
InChI: |
InChI=1/C18H20N2O2S2/c1-2-11-5-7-13-14(10-11)24-18(16(13)17(19)22)20-15(21)8-6-12-4-3-9-23-12/h3-4,6,8-9,11H,2,5,7,10H2,1H3,(H2,19,22)(H,20,21)/b8-6-/t11-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 360.502 g/mol | logS: -6.00374 | SlogP: 4.07524 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0450268 | Sterimol/B1: 2.4747 | Sterimol/B2: 2.53864 | Sterimol/B3: 4.35136 |
Sterimol/B4: 9.356 | Sterimol/L: 15.3673 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 600.747 | Positive charged surface: 364.225 | Negative charged surface: 236.522 | Volume: 328.875 |
Hydrophobic surface: 462.001 | Hydrophilic surface: 138.746 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |