Type: Neutral
Formula: C17H18N4O3
SMILES: |
OC=1NC(=O)NC(=O)C=1\C=N\C(Cc1c2c([nH]c1)cccc2)CC |
InChI: |
InChI=1/C17H18N4O3/c1-2-11(7-10-8-19-14-6-4-3-5-12(10)14)18-9-13-15(22)20-17(24)21-16(13)23/h3-6,8-9,11,19H,2,7H2,1H3,(H3,20,21,22,23,24)/b18-9+/t11-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 326.356 g/mol | logS: -3.1615 | SlogP: 2.16877 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.265934 | Sterimol/B1: 2.30892 | Sterimol/B2: 3.86514 | Sterimol/B3: 4.48749 |
Sterimol/B4: 9.48249 | Sterimol/L: 12.6372 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 539.913 | Positive charged surface: 353.512 | Negative charged surface: 183.698 | Volume: 304.625 |
Hydrophobic surface: 303.318 | Hydrophilic surface: 236.595 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |