Type: Neutral
Formula: C15H15BrN6
SMILES: |
Brc1ccc(NCc2cnc3nc(nc(N)c3c2C)N)cc1 |
InChI: |
InChI=1/C15H15BrN6/c1-8-9(6-19-11-4-2-10(16)3-5-11)7-20-14-12(8)13(17)21-15(18)22-14/h2-5,7,19H,6H2,1H3,(H4,17,18,20,21,22) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 359.231 g/mol | logS: -5.59677 | SlogP: 3.13862 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0672338 | Sterimol/B1: 2.54102 | Sterimol/B2: 2.8565 | Sterimol/B3: 4.62869 |
Sterimol/B4: 6.09246 | Sterimol/L: 18.3758 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 550.113 | Positive charged surface: 310.863 | Negative charged surface: 232.998 | Volume: 293.625 |
Hydrophobic surface: 339.113 | Hydrophilic surface: 211 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |