Type: Ionized
Formula: C6H12NO7P2-
SMILES: |
P(OP(O)(O)=O)(=O)(C(=N)C)CC(C(=O)[O-])C |
InChI: |
InChI=1/C6H13NO7P2/c1-4(6(8)9)3-15(10,5(2)7)14-16(11,12)13/h4,7H,3H2,1-2H3,(H,8,9)(H2,11,12,13)/p-1/b7-5-/t4-,15+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 272.11 g/mol | logS: 0.26537 | SlogP: -2.38343 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.231272 | Sterimol/B1: 3.01777 | Sterimol/B2: 3.61332 | Sterimol/B3: 4.39021 |
Sterimol/B4: 5.94217 | Sterimol/L: 11.4934 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 423.433 | Positive charged surface: 204.304 | Negative charged surface: 219.129 | Volume: 204.375 |
Hydrophobic surface: 129.681 | Hydrophilic surface: 293.752 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 5 | Acid groups: 2 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Parent related molecule:
|