Type: Neutral
Formula: C6H13NO7P2
SMILES: |
P(OP(O)(O)=O)(=O)(C(=N)C)CC(C(O)=O)C |
InChI: |
InChI=1/C6H13NO7P2/c1-4(6(8)9)3-15(10,5(2)7)14-16(11,12)13/h4,7H,3H2,1-2H3,(H,8,9)(H2,11,12,13)/b7-5-/t4-,15+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 273.118 g/mol | logS: 0.52582 | SlogP: -1.04873 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.164554 | Sterimol/B1: 2.64016 | Sterimol/B2: 3.74621 | Sterimol/B3: 4.47825 |
Sterimol/B4: 5.83773 | Sterimol/L: 12.1737 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 440.914 | Positive charged surface: 237.805 | Negative charged surface: 203.109 | Volume: 208.625 |
Hydrophobic surface: 133.07 | Hydrophilic surface: 307.844 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 6 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules
|