Type: Neutral
Formula: C10H16N4O5S
SMILES: |
S(C)C=1NC(N)=C(NC2OCC(O)C(O)C2O)C(=O)N=1 |
InChI: |
InChI=1/C10H16N4O5S/c1-20-10-13-7(11)4(8(18)14-10)12-9-6(17)5(16)3(15)2-19-9/h3,5-6,9,12,15-17H,2H2,1H3,(H3,11,13,14,18)/t3-,5-,6+,9+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 304.327 g/mol | logS: -1.15764 | SlogP: -3.0084 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.100748 | Sterimol/B1: 1.969 | Sterimol/B2: 3.2688 | Sterimol/B3: 4.4121 |
Sterimol/B4: 6.65253 | Sterimol/L: 14.739 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 498.848 | Positive charged surface: 342.241 | Negative charged surface: 156.608 | Volume: 251.5 |
Hydrophobic surface: 181.144 | Hydrophilic surface: 317.704 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 6 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |