Type: Neutral
Formula: C11H14N2O5S
SMILES: |
S1C(CO)C(O)CC1N1C=C(C(=O)C)C(=O)NC1=O |
InChI: |
InChI=1/C11H14N2O5S/c1-5(15)6-3-13(11(18)12-10(6)17)9-2-7(16)8(4-14)19-9/h3,7-9,14,16H,2,4H2,1H3,(H,12,17,18)/t7-,8+,9+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 286.308 g/mol | logS: -1.4735 | SlogP: -0.8041 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.0872465 | Sterimol/B1: 3.5506 | Sterimol/B2: 3.70505 | Sterimol/B3: 3.85115 |
Sterimol/B4: 4.06943 | Sterimol/L: 14.522 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 466.502 | Positive charged surface: 302.444 | Negative charged surface: 164.058 | Volume: 237.25 |
Hydrophobic surface: 223.563 | Hydrophilic surface: 242.939 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |