Type: Neutral
Formula: C8H16N2O6
SMILES: |
O1C(CO)C(O)C(O)C(NC(=O)C)C1(O)N |
InChI: |
InChI=1/C8H16N2O6/c1-3(12)10-7-6(14)5(13)4(2-11)16-8(7,9)15/h4-7,11,13-15H,2,9H2,1H3,(H,10,12)/t4-,5-,6+,7-,8-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 236.224 g/mol | logS: 0.94493 | SlogP: -3.7912 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0985415 | Sterimol/B1: 3.28907 | Sterimol/B2: 3.33846 | Sterimol/B3: 4.44006 |
Sterimol/B4: 4.65791 | Sterimol/L: 12.8997 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 422.376 | Positive charged surface: 305.611 | Negative charged surface: 116.765 | Volume: 199.5 |
Hydrophobic surface: 166.974 | Hydrophilic surface: 255.402 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 6 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |